CAS 77940-94-4

3-piperidin-1-ylbenzoic acid

Description:

3-Piperidin-1-ylbenzoic acid, with the CAS number 77940-94-4, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a piperidine ring at the meta position. This compound typically exhibits properties associated with both aromatic and aliphatic structures, contributing to its potential biological activity. It is generally a white to off-white solid at room temperature and is soluble in polar organic solvents. The piperidine ring provides basicity due to the nitrogen atom, which can participate in hydrogen bonding and influence the compound's reactivity and interaction with biological targets. The carboxylic acid functional group contributes to its acidity and can engage in various chemical reactions, such as esterification or amidation. 3-Piperidin-1-ylbenzoic acid is of interest in medicinal chemistry for its potential applications in drug development, particularly in the synthesis of compounds with therapeutic properties. As with many organic compounds, handling should be done with care, following appropriate safety protocols.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1/C12H15NO2/c14-12(15)10-5-4-6-11(9-10)13-7-2-1-3-8-13/h4-6,9H,1-3,7-8H2,(H,14,15)

SMILES: C1CCN(CC1)c1cccc(c1)C(=O)O

Synonyms:

• 3-Piperidinobenzoic Acid
• Benzoic Acid, 3-(1-Piperidinyl)-

3-Piperidinobenzoic acid

CAS: 77940-94-4

Formula: C₁₂H₁₅NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.2530

Ref: IN-DA0056I3

3-(Piperidin-1-yl)benzoic acid

CAS: 77940-94-4

3-(Piperidin-1-yl)benzoic acid

Formula: C₁₂H₁₅NO₂

Purity: ≥95%

Color and Shape: off-white. crystals or powder

Molecular weight: 205.25g/mol

Ref: 54-OR0764

Piperidine Impurity 2

CAS: 77940-94-4

Formula: C₁₂H₁₅NO₂

Molecular weight: 205.26

Ref: 4Z-P-147055

3-(Piperidin-1-yl)benzoic acid

CAS: 77940-94-4

Purity: 95%

Molecular weight: 205.2570038

Ref: 10-F640894

3-Piperidin-1-yl-benzoic acid

CAS: 77940-94-4

3-Piperidin-1-yl-benzoic acid is a cyclic compound that belongs to the class of 2-nitrobenzoic acids. The human body metabolizes these compounds by nitrosation, which leads to the formation of an aminobenzoate and an aminobenzoic acid. This process is facilitated by the enzyme nitroreductase. 3-Piperidin-1-yl-benzoic acid has been found to be efficient in vitro for the proliferation of prostate cancer cells. It also has a low toxicity for humans and can be used as a potential chemotherapeutic agent.

Formula: C₁₂H₁₅NO₂

Purity: Min. 95%

Molecular weight: 205.26 g/mol

Ref: 3D-CDA94094

Piperidine Related Compound 2

CAS: 77940-94-4

Formula: C₁₂H₁₅NO₂

Molecular weight: 205.26

Ref: ST-EA-CP-P215019