CAS 77941-92-5
:5,7-dimethoxy-2,3-dimethyl-indan-1-one
Description:
5,7-Dimethoxy-2,3-dimethyl-indan-1-one is an organic compound characterized by its indanone structure, which features a ketone functional group within an indane framework. This compound is notable for its two methoxy groups located at the 5 and 7 positions, as well as two methyl groups at the 2 and 3 positions of the indan ring. These substituents contribute to its chemical reactivity and potential biological activity. The presence of methoxy groups can enhance lipophilicity, influencing the compound's solubility and interaction with biological membranes. Additionally, the methyl groups may affect the steric hindrance and electronic properties of the molecule. This compound may be of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential applications in drug development or as a synthetic intermediate. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as temperature and pH.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c1-7-8(2)13(14)12-10(7)5-9(15-3)6-11(12)16-4/h5-8H,1-4H3
Synonyms:- 5,7-Dimethoxy-2,3-dimethyl-indan-1-
- one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.