CAS 77943-33-0
:2,3,4-Tri-O-benzyl-beta-L-arabinopyranose
Description:
2,3,4-Tri-O-benzyl-beta-L-arabinopyranose is a glycoside derivative of L-arabinose, characterized by the presence of three benzyl groups attached to the hydroxyl positions at the 2, 3, and 4 carbon atoms of the sugar moiety. This compound is typically a white to off-white solid, exhibiting a crystalline structure. It is soluble in organic solvents such as methanol, ethanol, and dichloromethane, but has limited solubility in water due to the hydrophobic nature of the benzyl groups. The presence of these benzyl groups enhances the compound's stability and lipophilicity, making it useful in various organic synthesis applications, particularly in the field of carbohydrate chemistry. Additionally, it can serve as a protecting group in glycosylation reactions. The compound's structure allows for potential biological activity, although specific biological properties would depend on the context of its use and further investigation. As with many organic compounds, proper handling and safety precautions should be observed due to potential reactivity and toxicity.
Formula:C26H28O5
InChI:InChI=1/C26H28O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(19-31-26)28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25?,26-/m1/s1
SMILES:c1ccc(cc1)CO[C@@H]1CO[C@H](C([C@@H]1OCc1ccccc1)OCc1ccccc1)O
Synonyms:- (2R,4R,5R)-3,4,5-tribenzyloxytetrahydropyran-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3,4-Tri-O-benzyl-b-L-arabinopyranose
CAS:2,3,4-Tri-O-benzyl-b-L-arabinopyranose is a glycosylated monosaccharide that can be custom synthesized and fluorinated. It has been used in the methylation of saccharides to produce complex carbohydrates such as polysaccharides and oligosaccharides. The product is also capable of being modified, wherein it has been shown that click modification can be carried out on 2,3,4-Tri-O-benzyl-b-L-arabinopyranose. This modification is a convenient method for the introduction of both hydrophilic and hydrophobic groups on the molecule. Methylation: 2,3,4 Tri O benzyl b L arabinopyranose Glycosylation: 2,3,4 Tri O benzyl b L arabinopyranose Polysaccharide:Formula:C26H28O5Purity:Min. 95%Color and Shape:Yellow SolidMolecular weight:420.5 g/mol



