CAS 77946-49-7
:(2E)-2-[amino(phenyl)methylidene]-1-benzothiophen-3(2H)-one
Description:
The chemical substance known as (2E)-2-[amino(phenyl)methylidene]-1-benzothiophen-3(2H)-one, with the CAS number 77946-49-7, is characterized by its unique structural features that include a benzothiophene core and an imine functional group. This compound typically exhibits a yellow to brown coloration and is soluble in organic solvents, reflecting its aromatic nature. The presence of the amino and phenyl groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit various properties such as fluorescence or photostability, depending on its specific molecular interactions. Its structural configuration allows for potential hydrogen bonding and π-π stacking interactions, which can influence its reactivity and interactions with biological targets. Additionally, the compound may undergo various chemical reactions, including nucleophilic attacks and electrophilic substitutions, which are common in compounds containing both nitrogen and sulfur functionalities. Overall, this substance represents a class of organic compounds with potential applications in pharmaceuticals and materials science.
Formula:C15H11NOS
InChI:InChI=1/C15H11NOS/c16-13(10-6-2-1-3-7-10)15-14(17)11-8-4-5-9-12(11)18-15/h1-9H,16H2/b15-13+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AF-CX 921XX
CAS:AF-CX 921XX is an antiepileptic agent.Formula:C15H11NOSColor and Shape:SolidMolecular weight:253.32
