
CAS 7795-91-7
:2-(1-Methylpropoxy)ethanol
Description:
2-(1-Methylpropoxy)ethanol, also known by its CAS number 7795-91-7, is an organic compound characterized by its ether and alcohol functional groups. It typically appears as a colorless liquid with a moderate boiling point and a relatively low viscosity, making it suitable for various applications in solvents and chemical intermediates. The presence of the ether group contributes to its solubility in both polar and non-polar solvents, enhancing its utility in formulations. This compound is often used in the production of coatings, adhesives, and cleaning agents due to its ability to dissolve a wide range of substances. Additionally, it exhibits moderate toxicity, necessitating appropriate handling and safety measures during use. Its chemical structure allows for hydrogen bonding, which can influence its physical properties, such as surface tension and volatility. Overall, 2-(1-Methylpropoxy)ethanol is valued in industrial applications for its solvent properties and versatility in chemical synthesis.
Formula:C6H14O2
InChI:InChI=1S/C6H14O2/c1-3-6(2)8-5-4-7/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=HUWFDQSAXOIUNP-UHFFFAOYSA-N
SMILES:C(OCCO)(CC)C
Synonyms:- Ethanol, 2-sec-butoxy-
- Ethylene glycol mono-sec-butyl ether
- 2-(1-Methylpropoxy)ethanol
- 2-sec-Butoxyethanol
- Ethanol, 2-(1-methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
