CAS 7795-95-1
:1-Octanesulfonyl chloride
Description:
1-Octanesulfonyl chloride, with the CAS number 7795-95-1, is an organic compound characterized by its sulfonyl chloride functional group attached to an octane chain. It is a colorless to pale yellow liquid that is typically used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The compound is known for its strong electrophilic nature, making it highly reactive towards nucleophiles. It has a relatively high boiling point due to the presence of the sulfonyl group, which contributes to its polar characteristics. 1-Octanesulfonyl chloride is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. It is important to handle this compound with care, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this chemical.
Formula:C8H17ClO2S
InChI:InChI=1S/C8H17ClO2S/c1-2-3-4-5-6-7-8-12(9,10)11/h2-8H2,1H3
InChI key:InChIKey=WIVNTNLDTMNDNO-UHFFFAOYSA-N
SMILES:C(CCCCCCC)S(Cl)(=O)=O
Synonyms:- 1-Octanesulphonyl Chloride
- 1-Octylsulfonyl Chloride
- N-Octylsulfonyl Chloride
- Octane-1-Sulfonyl Chloride
- Octanesulfonyl Chloride
- Octylsulfonyl chloride
- Octylsulfonylchloride
- n-Octane sulfonyl chloride
- n-Octanesulfonyl chloride
- 1-Octanesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Octanesulfonyl Chloride
CAS:Formula:C8H17ClO2SPurity:>95.0%(GC)(T)Color and Shape:Colorless to Light red to Green clear liquidMolecular weight:212.73Octane-1-sulfonyl chloride
CAS:Formula:C8H17ClO2SPurity:95%Color and Shape:LiquidMolecular weight:212.7374Octane-1-sulfonyl chloride
CAS:Formula:C8H17ClO2SPurity:95.0%Color and Shape:ClearMolecular weight:212.731-Octanesulfonyl Chloride
CAS:1-Octanesulfonyl chloride is a chemical compound that belongs to the group of heterocyclic compounds. It is used in the synthesis of pharmaceutical drugs, such as ophthalmic drugs. 1-Octanesulfonyl chloride has been shown to inhibit methionine aminopeptidase, an enzyme that degrades proteins and peptides, which may be due to its proximity to hydroxy groups. This compound also has a phase transition temperature of -103°C, which means it can exist as a liquid or solid at room temperature. The presence of fluorine in this compound gives it a sharp nmr spectrum with signals seen between 0.8 and 1.2 ppm. This chemical reacts with water and other molecules to form new molecules that have different properties, such as the formation of chlorides from hydrogen chloride gas and 1-octanesulfonyl chloride.Formula:C8H17ClO2SPurity:Min. 95%Molecular weight:212.73 g/mol




