CAS 77975-79-2

3-Methyl-1-(2-propyn-1-yl)piperidine

Description:

3-Methyl-1-(2-propyn-1-yl)piperidine, with the CAS number 77975-79-2, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a methyl group at the 3-position and a propynyl group at the 1-position of the piperidine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinct odor. The presence of the alkyne functional group (propynyl) imparts reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. As with many nitrogen-containing compounds, it may exhibit basic properties, and safety precautions should be taken when handling it due to potential toxicity and reactivity.

Formula: C₉H₁₅N

InChI: InChI=1S/C9H15N/c1-3-6-10-7-4-5-9(2)8-10/h1,9H,4-8H2,2H3

InChI key: InChIKey=AAYFKDVXDDHACZ-UHFFFAOYSA-N

SMILES: C(C#C)N1CC(C)CCC1

Synonyms:

• 3-Methyl-1-(2-propyn-1-yl)piperidine
• Piperidine, 3-methyl-1-(2-propynyl)-
• Piperidine, 3-methyl-1-(2-propyn-1-yl)-