CAS 77987-49-6
:N-Z-ethanolamine
Description:
N-Z-ethanolamine, with the CAS number 77987-49-6, is a chemical compound that belongs to the class of ethanolamines, which are characterized by the presence of both an amino group and a hydroxyl group in their structure. This compound typically exhibits properties such as being a colorless to pale yellow liquid with a slight amine odor. It is soluble in water and various organic solvents, making it versatile for different applications. N-Z-ethanolamine is often used in the formulation of surfactants, emulsifiers, and as a chemical intermediate in the production of various industrial products. Its chemical structure allows it to participate in reactions typical of both amines and alcohols, which can lead to a range of derivatives. Additionally, it may have applications in pharmaceuticals, personal care products, and agricultural chemicals. As with many amines, it is important to handle N-Z-ethanolamine with care due to potential irritant properties and to follow appropriate safety guidelines during its use.
Formula:C10H13NO3
InChI:InChI=1/C10H13NO3/c12-7-6-11-10(13)14-8-9-4-2-1-3-5-9/h1-5,12H,6-8H2,(H,11,13)
SMILES:c1ccc(cc1)COC(=NCCO)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzyl N-(2-hydroxyethyl)carbamate
CAS:Formula:C10H13NO3Purity:95%Color and Shape:SolidMolecular weight:195.21512-(Benzyloxycarbonylamino)-1-ethanol
CAS:Formula:C10H13NO3Purity:>97.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:195.22Benzyl N-(2-hydroxyethyl)carbamate
CAS:Benzyl N-(2-hydroxyethyl)carbamatePurity:97%Molecular weight:195.22g/molN-(Benzyloxycarbonyl)ethanolamine
CAS:Controlled ProductApplications N-(Benzyloxycarbonyl)ethanolamine is an intermediate used to prepare alkynylaryladenines as A2A adenosine receptor agonists and effects on hepatic glucose production. It is also used in the synthesis of functionalized N-arylaminoethyl amides as noncovalent inhibitors of cathepsin S.
References Harada, H., et al.: Bioorg. Med. Chem., 9, 2709 (2001); Tully, D., et al.: Bioorg. Med. Chem. Lett., 16, 5112 (2006)Formula:C10H13NO3Color and Shape:NeatMolecular weight:195.215




