CAS 77988-07-9
:methyl (2S,3R,4S)-4-(2,2-dimethoxyethyl)-3-ethenyl-2-(beta-D-glucopyranosyloxy)-3,4-dihydro-2H-pyran-5-carboxylate
Description:
Methyl (2S,3R,4S)-4-(2,2-dimethoxyethyl)-3-ethenyl-2-(beta-D-glucopyranosyloxy)-3,4-dihydro-2H-pyran-5-carboxylate is a complex organic compound characterized by its multi-functional groups and stereochemistry. This substance features a pyran ring, which is a six-membered cyclic ether, and incorporates a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a glucopyranosyl moiety indicates that it is a glycoside, which may enhance its solubility in water and biological activity. The dimethoxyethyl group adds to its structural complexity and may influence its physical properties, such as boiling point and polarity. The specific stereochemistry (2S,3R,4S) suggests that the compound has distinct spatial arrangements that can affect its interaction with biological systems, potentially making it of interest in medicinal chemistry or as a natural product derivative. Overall, this compound exemplifies the intricate nature of organic molecules and their potential utility in various chemical and pharmaceutical applications.
Formula:C19H30O11
InChI:InChI=1/C19H30O11/c1-5-9-10(6-13(25-2)26-3)11(17(24)27-4)8-28-18(9)30-19-16(23)15(22)14(21)12(7-20)29-19/h5,8-10,12-16,18-23H,1,6-7H2,2-4H3/t9-,10+,12-,14-,15+,16-,18+,19+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Secologanin dimethyl acetal
CAS:Secologanin dimethyl acetal induces significant neurite outgrowth.Formula:C19H30O11Purity:98%Color and Shape:SolidMolecular weight:434.43Secologanin dimethylacetal
CAS:Formula:C19H30O11Purity:95%~99%Color and Shape:PowderMolecular weight:434.438Secologanin acetal
CAS:Secologanin acetal is a lonicerae japonicae schisandrae fruit extract that is used in traditional Chinese medicines. It has been shown to have anti-inflammatory, anti-tumor, and antiviral activities. Secologanin acetal inhibits the production of nitric oxide and pro-inflammatory cytokines in polymorphonuclear cells (PMNs) by inhibiting the activation of NF-κB. Structural formula:Formula:C19H30O11Purity:Min. 95%Molecular weight:434.4 g/mol




