CAS 77995-07-4

Ethyl 2,4-diphenyl-5-pyrimidinecarboxylate

Description:

Ethyl 2,4-diphenyl-5-pyrimidinecarboxylate, with the CAS number 77995-07-4, is an organic compound characterized by its pyrimidine ring structure, which is substituted at the 2 and 4 positions with phenyl groups and at the 5 position with an ethyl ester of a carboxylic acid. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the phenyl groups. Ethyl 2,4-diphenyl-5-pyrimidinecarboxylate may possess interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the presence of the ester functional group, which may undergo hydrolysis under certain conditions. Overall, this compound represents a unique structure within the realm of pyrimidine derivatives, with potential implications in various chemical and pharmaceutical fields.

Formula: C₁₉H₁₆N₂O₂

InChI: InChI=1S/C19H16N2O2/c1-2-23-19(22)16-13-20-18(15-11-7-4-8-12-15)21-17(16)14-9-5-3-6-10-14/h3-13H,2H2,1H3

InChI key: InChIKey=IXTIONINVUBJLO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=NC(=NC1)C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• Ethyl 2,4-diphenyl-5-pyrimidinecarboxylate
• 5-Pyrimidinecarboxylic acid, 2,4-diphenyl-, ethyl ester