4-Hydrazinyl-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a benzothieno-pyrimidine framework. This compound features a hydrazine functional group, which contributes to its reactivity and potential biological activity. The presence of the tetrahydro moiety indicates that the compound is saturated, which can influence its physical properties, such as solubility and stability. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly leading to applications in drug development. Additionally, the presence of nitrogen atoms in the hydrazine and pyrimidine components may impart unique electronic properties, affecting the compound's reactivity and interaction with other molecules. Overall, 4-hydrazinyl-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine represents a class of compounds that could be explored for their therapeutic potential and chemical behavior in various applications.

C11H14N4S - InChI=1/C11H14N4S/c1-6-13-10(15-12)9-7-4-2-3-5-8(7)16-11(9)14-6/h2-5,12H2,1H3,(H,13,14,15)

4-hydrazinyl-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine

77995-54-1: 4-Hydrazinyl-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a benzothieno-pyrimidine framework. This compound features a hydrazine functional group, which contributes to its reactivity and potential biological activity. The presence of the tetrahydro moiety indicates that the compound is saturated, which can influence its physical properties, such as solubility and stability. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly leading to applications in drug development. Additionally, the presence of nitrogen atoms in the hydrazine and pyrimidine components may impart unique electronic properties, affecting the compound's reactivity and interaction with other molecules. Overall, 4-hydrazinyl-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine represents a class of compounds that could be explored for their therapeutic potential and chemical behavior in various applications.

CAS 77995-54-1

4-hydrazinyl-2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine

3-Hydrazinyl-5-methyl-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraene

Ref: 3D-CDA99554