CAS 78-97-7
:Lactonitrile
Description:
Lactonitrile, with the CAS number 78-97-7, is an organic compound characterized by its structure, which features a nitrile group (-C≡N) adjacent to a lactone ring. It is a colorless to pale yellow liquid with a faint odor and is known for its polar nature, which allows it to dissolve in various organic solvents. Lactonitrile has a relatively low boiling point and is sensitive to moisture, which can lead to hydrolysis. This compound is primarily used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. It exhibits moderate toxicity, necessitating careful handling to avoid inhalation or skin contact. Additionally, lactonitrile can participate in various chemical reactions, including nucleophilic additions and cyclization processes, making it a valuable building block in synthetic organic chemistry. Its unique properties and reactivity profile make it an important substance in both industrial and research applications.
Formula:C3H5NO
InChI:InChI=1S/C3H5NO/c1-3(5)2-4/h3,5H,1H3
InChI key:InChIKey=WOFDVDFSGLBFAC-UHFFFAOYSA-N
SMILES:C(C#N)(C)O
Synonyms:- (±)-2-Hydroxypropionitrile
- 2-Hydroxypropanenitrile
- Acetaldehyde Cyanohydrin
- Acetocyanohydrin
- NSC 7764
- Propanenitrile, 2-hydroxy-
- α-Hydroxypropionitrile
- Lactonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Hydroxypropanenitrile
CAS:2-Hydroxypropanenitrile is an organic compound with a hydroxyl group in the alpha position. It is used as a reactant in organic synthesis and as a reagent for the preparation of metal hydroxides. 2-Hydroxypropanenitrile can be prepared by the reaction of phosphorus pentoxide, hydrogen gas, and ammonia. Hydroxyl groups can form acids when combined with metal hydroxides and inorganic acids such as phosphoric acid. The mechanism of this process has been studied using various techniques including X-ray diffraction. This compound is also used to promote cross-linking reactions between amide groups by forming amide bonds and for inducing enzyme activity.
Formula:C3H5NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:71.08 g/mol
