CAS 780-05-2

N-(4-fluorophenyl)maleamic acid

Description:

N-(4-fluorophenyl)maleamic acid is an organic compound characterized by its maleamic acid structure, which features a maleic acid backbone modified with a 4-fluorophenyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, including the ability to form hydrogen bonds due to the presence of the amine and carboxylic acid functional groups. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to its functional groups. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. N-(4-fluorophenyl)maleamic acid may be of interest in pharmaceutical research, particularly in the development of drugs or as a building block in organic synthesis. Its CAS number, 780-05-2, allows for easy identification in chemical databases and literature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₀H₈FNO₃

InChI: InChI=1/C10H8FNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5-

SMILES: c1cc(ccc1F)NC(=O)/C=C\C(=O)O

Synonyms:

• Maleic acid mono(4-fluorophenyl)amide
• (2Z)-4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid

(Z)-4-((4-Fluorophenyl)amino)-4-oxobut-2-enoic acid

CAS: 780-05-2

Formula: C₁₀H₈FNO₃

Molecular weight: 209.1738

Ref: IN-DA003SCI

4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid

CAS: 780-05-2

4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid

Purity: 95%

Molecular weight: 209.18g/mol

Ref: 54-PC104069