CAS 780-85-8
:5,5-diethyl-2-phenyl-1,3-dioxane
Description:
5,5-Diethyl-2-phenyl-1,3-dioxane, with the CAS number 780-85-8, is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound typically exhibits a colorless to pale yellow appearance and is known for its aromatic properties due to the presence of the phenyl group. It is soluble in organic solvents and may have limited solubility in water. The presence of ethyl groups contributes to its hydrophobic characteristics, while the dioxane ring can influence its reactivity and stability. 5,5-Diethyl-2-phenyl-1,3-dioxane may be utilized in various chemical applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its chemical behavior can be influenced by factors such as temperature and the presence of other reagents, making it a compound of interest in both academic and industrial chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C14H20O2
InChI:InChI=1/C14H20O2/c1-3-14(4-2)10-15-13(16-11-14)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3
SMILES:CCC1(CC)COC(c2ccccc2)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.