CAS 780-90-5

2-Methoxy-5-[(trifluoromethyl)sulfonyl]benzenamine

Description:

2-Methoxy-5-[(trifluoromethyl)sulfonyl]benzenamine, with the CAS number 780-90-5, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a trifluoromethylsulfonyl group attached to a benzene ring. This compound typically appears as a solid or liquid, depending on the specific conditions. It is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of the sulfonamide functional group, which can enhance biological activity. The trifluoromethyl group contributes to its lipophilicity and can influence the compound's reactivity and stability. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially enhancing its solubility in organic solvents. Safety data indicates that, like many sulfonamides, it should be handled with care, as it may pose health risks upon exposure. Overall, 2-Methoxy-5-[(trifluoromethyl)sulfonyl]benzenamine is a compound of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₈H₈F₃NO₃S

InChI: InChI=1S/C8H8F3NO3S/c1-15-7-3-2-5(4-6(7)12)16(13,14)8(9,10)11/h2-4H,12H2,1H3

InChI key: InChIKey=PLESGWQBPARRQO-UHFFFAOYSA-N

SMILES: S(C(F)(F)F)(=O)(=O)C1=CC(N)=C(OC)C=C1

Synonyms:

• 2-Methoxy-5-(trifluoromethanesulfonyl)phenylamine
• o-Anisidine, 5-[(trifluoromethyl)sulfonyl]-
• 2-Methoxy-5-(trifluoromethylsulfonyl)aniline
• Benzenamine, 2-methoxy-5-[(trifluoromethyl)sulfonyl]-
• 2-Methoxy-5-[(trifluoromethyl)sulfonyl]benzenamine

2-Methoxy-5-trifluoromethanesulfonylaniline

CAS: 780-90-5

Versatile small molecule scaffold

Formula: C₈H₈F₃NO₃S

Purity: Min. 95%

Molecular weight: 255.22 g/mol

Ref: 3D-AAA78090