CAS 78003-71-1
:13,14-didehydromatridin-15-one hydrobromide
Description:
13,14-Didehydromatridin-15-one hydrobromide is a chemical compound that belongs to the class of alkaloids, specifically derived from the matrinic family. It is characterized by its unique molecular structure, which includes a tetracyclic framework typical of many alkaloids. The presence of a hydrobromide indicates that it is a salt formed with hydrobromic acid, which can enhance its solubility in polar solvents. This compound may exhibit biological activity, as many alkaloids are known for their pharmacological properties, including potential anti-inflammatory and analgesic effects. Its specific interactions and mechanisms of action would depend on its chemical properties and the biological systems it interacts with. As with many chemical substances, safety and handling precautions are essential, particularly due to the potential for toxicity associated with alkaloids. Further research and characterization are necessary to fully understand its applications and effects in various fields, including medicinal chemistry and pharmacology.
Formula:C15H23BrN2O
InChI:InChI=1/C15H22N2O.BrH/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14;/h1,7,11-13,15H,2-6,8-10H2;1H/t11-,12+,13+,15-;/m0./s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
