CAS 78014-22-9

N-(3-Methoxypropyl)-2,2,6,6-tetramethyl-4-piperidinamine

Description:

N-(3-Methoxypropyl)-2,2,6,6-tetramethyl-4-piperidinamine, with the CAS number 78014-22-9, is a chemical compound characterized by its piperidine structure, which includes a piperidinamine core substituted with two tert-butyl groups and a methoxypropyl group. This compound is typically classified as an amine and may exhibit properties such as being a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is known for its potential applications in various fields, including organic synthesis and as a stabilizer in polymer chemistry. The presence of the methoxy group suggests it may have moderate polarity, influencing its solubility in organic solvents. Additionally, the bulky tert-butyl groups can impart steric hindrance, affecting its reactivity and interactions with other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health hazards associated with amines.

Formula: C₁₃H₂₈N₂O

InChI: InChI=1S/C13H28N2O/c1-12(2)9-11(10-13(3,4)15-12)14-7-6-8-16-5/h11,14-15H,6-10H2,1-5H3

InChI key: InChIKey=VDGDCVKCGHKYJP-UHFFFAOYSA-N

SMILES: N(CCCOC)C1CC(C)(C)NC(C)(C)C1

Synonyms:

• N-(3-Methoxypropyl)-2,2,6,6-tetramethyl-4-piperidinamine
• N-(3-Methoxypropyl)-2,2,6,6-tetramethyl-4-piperidineamine
• 4-Piperidinamine, N-(3-methoxypropyl)-2,2,6,6-tetramethyl-