CymitQuimica logo

CAS 78016-98-5

:

2-(trifluoromethyl)-1H-imidazole-4-carboxylic acid

Description:
2-(Trifluoromethyl)-1H-imidazole-4-carboxylic acid is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered aromatic structure containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The carboxylic acid functional group (-COOH) contributes to its acidity and reactivity, allowing for various chemical transformations and interactions. This compound is often utilized in pharmaceutical research and development due to its potential as a building block in drug synthesis. Its unique electronic properties, imparted by the trifluoromethyl group, can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and solubility characteristics are influenced by the presence of both the trifluoromethyl and carboxylic acid groups, which can affect its behavior in different solvents and under various conditions. Overall, 2-(trifluoromethyl)-1H-imidazole-4-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical applications.
Formula:C5H3F3N2O2
InChI:InChI=1S/C5H3F3N2O2/c6-5(7,8)4-9-1-2(10-4)3(11)12/h1H,(H,9,10)(H,11,12)
InChI key:InChIKey=DQPSZGHYQKCZEY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1NC(C(O)=O)=CN1
Synonyms:
  • 1H-Imidazole-4-carboxylic acid, 2-(trifluoromethyl)-
  • 1H-imidazole-5-carboxylic acid, 2-(trifluoromethyl)-
  • 2-(Trifluoromethyl)-1H-imidazole-5-carboxylic acid
  • 2-Trifluoromethylimidazole-4-carboxylic acid
  • 2-(Trifluoromethyl)-1H-imidazole-4-carboxylic acid
Found 4 products.