CAS 78027-00-6
:4-amino-5-(pyridin-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
4-amino-5-(pyridin-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a pyridine moiety, contributing to its potential biological activity. The presence of the thione functional group (a sulfur atom double-bonded to a carbon atom) enhances its reactivity and may influence its interactions with biological targets. The compound is likely to exhibit properties such as solubility in polar solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The triazole framework is known for its role in various biological activities, including antifungal and antimicrobial properties. Additionally, the compound's specific stereochemistry and substituents can affect its pharmacokinetics and pharmacodynamics, making it a subject of interest in drug design and development. Overall, this compound represents a unique combination of structural features that may lead to diverse applications in chemistry and biology.
Formula:C7H7N5S
InChI:InChI=1/C7H7N5S/c8-12-6(10-11-7(12)13)5-2-1-3-9-4-5/h1-4H,8H2,(H,11,13)
SMILES:c1cc(cnc1)c1nnc(n1N)S
Synonyms:- 3H-1,2,4-Triazole-3-thione, 4-amino-2,4-dihydro-5-(3-pyridinyl)-
- 4-Amino-5-(pyridin-3-yl)-4H-1,2,4-triazole-3-thiol
- 4H-1,2,4-Triazole-3-thiol, 4-amino-5-(3-pyridinyl)-
- 4-Amino-5-(pyridin-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
