CAS 78028-01-0
:5-[2-[4-(Ethoxycarbonyl)phenyl]diazenyl]-2-hydroxybenzeneacetic acid
Description:
5-[2-[4-(Ethoxycarbonyl)phenyl]diazenyl]-2-hydroxybenzeneacetic acid, identified by its CAS number 78028-01-0, is an organic compound characterized by its azo dye structure, which features a diazo group (-N=N-) linking two aromatic systems. This compound typically exhibits vibrant colors due to the presence of the azo group, making it useful in dye applications. The ethoxycarbonyl group contributes to its solubility and reactivity, while the hydroxy and carboxylic acid functional groups enhance its potential for hydrogen bonding and interaction with other molecules. This compound may exhibit properties such as UV-Vis absorbance, which is common in azo compounds, and it may also show biological activity, although specific biological properties would require further investigation. Its synthesis often involves diazotization reactions and coupling with phenolic compounds. Overall, this compound's unique structure and functional groups make it of interest in fields such as dye chemistry, materials science, and potentially in pharmaceuticals.
Formula:C17H16N2O5
InChI:InChI=1S/C17H16N2O5/c1-2-24-17(23)11-3-5-13(6-4-11)18-19-14-7-8-15(20)12(9-14)10-16(21)22/h3-9,20H,2,10H2,1H3,(H,21,22)
InChI key:InChIKey=YYBSDOZYJSGLTH-UHFFFAOYSA-N
SMILES:N(=NC1=CC=C(C(OCC)=O)C=C1)C2=CC(CC(O)=O)=C(O)C=C2
Synonyms:- CK 47A
- 5-[2-[4-(Ethoxycarbonyl)phenyl]diazenyl]-2-hydroxybenzeneacetic acid
- Ph CK 47A
- Benzeneacetic acid, 5-[2-[4-(ethoxycarbonyl)phenyl]diazenyl]-2-hydroxy-
- Benzeneacetic acid, 5-[[4-(ethoxycarbonyl)phenyl]azo]-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
CAY10397
CAS:CAY10397, a selective inhibitor of 15-hydroxy PGDH, significantly suppresses endogenous 11-oxo-ETE production with a corresponding increase in 11(R)-HETE.Formula:C17H16N2O5Color and Shape:SolidMolecular weight:328.32

