CAS 78032-05-0
:6-methylphthalazine
Description:
6-Methylphthalazine is a heterocyclic organic compound characterized by its fused ring structure, which includes a phthalazine core with a methyl group attached at the 6-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the methyl group can influence its reactivity and interaction with other chemical species. 6-Methylphthalazine may also exhibit specific physical properties such as melting and boiling points, which are important for its handling and application. Additionally, like many heterocycles, it may possess biological activity, making it of interest for further research in medicinal chemistry. Safety data sheets should be consulted for information regarding toxicity and safe handling practices, as with any chemical substance. Overall, 6-methylphthalazine represents a versatile compound with potential utility in various chemical and industrial applications.
Formula:C9H8N2
InChI:InChI=1/C9H8N2/c1-7-2-3-8-5-10-11-6-9(8)4-7/h2-6H,1H3
SMILES:Cc1ccc2cnncc2c1
Synonyms:- Phthalazine, 6-Methyl-
- 6-Methylphthalazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Methyl phthalazine
CAS:6-Methyl phthalazine is an organic compound with a molecular formula of C8H6N2. It is the methylated derivative of phthalazine. 6-Methyl phthalazine can be synthesized from 2-bromobenzaldehyde and benzaldehyde in two steps, producing an efficient synthesis of this compound. The first step consists of formylation of the aromatic ring followed by lithiation and cyclization to produce the desired product. The second step involves a sequence that begins with deprotection, proceeds with hydrazine formation, and ends with acetal cleavage to release the product.Formula:C9H8N2Purity:Min. 95%Color and Shape:White PowderMolecular weight:144.17 g/mol

