CAS 78033-08-6
:8-Methoxymethyl-3-isobutyl-1-methylxanthine
Description:
8-Methoxymethyl-3-isobutyl-1-methylxanthine, identified by its CAS number 78033-08-6, is a synthetic compound belonging to the xanthine class of molecules, which are known for their role as stimulants and phosphodiesterase inhibitors. This compound features a complex structure characterized by a xanthine core, which is modified with methoxymethyl and isobutyl groups, contributing to its unique pharmacological properties. It is typically studied for its potential effects on the central nervous system and its ability to enhance cognitive function. The presence of the methoxymethyl group may influence its solubility and bioavailability, while the isobutyl group can affect its interaction with biological targets. As a xanthine derivative, it may exhibit properties similar to caffeine and theophylline, including vasodilation and increased heart rate. However, specific biological activities, therapeutic applications, and safety profiles would require further investigation through empirical studies. Overall, this compound represents a fascinating area of research within medicinal chemistry and pharmacology.
Formula:C12H18N4O3
InChI:InChI=1S/C12H18N4O3/c1-7(2)5-16-10-9(11(17)15(3)12(16)18)13-8(14-10)6-19-4/h7H,5-6H2,1-4H3,(H,13,14)
InChI key:InChIKey=NBLBCGUCPBXKOV-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C2=C(NC(COC)=N2)C(=O)N(C)C1=O
Synonyms:- 1-Methyl-3-isobutyl-8-methoxymethylxanthine
- 1H-Purine-2,6-dione, 3,7-dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)-
- 1H-Purine-2,6-dione, 3,9-dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)-
- 3,9-Dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)-1H-purine-2,6-dione
- 3-Isobutyl-8-(methoxymethyl)-1-methyl-1H-purine-2,6(3H,7H)-dione
- 8-(Methoxymethyl)-1-methyl-3-(2-methylpropy l)-7H-purine-2,6-dione
- 8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)-3,7-dihydro-1H-purine-2,6-dione
- 8-Methoxymethyl-3-isobutyryl-1-methylxanthine
- 8-Methoxymethyl-3-isobutyl-1-methylxanthine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
8-Methoxymethyl-isobutyryl-1-methylxanthine
CAS:Formula:C12H18N4O3Color and Shape:SolidMolecular weight:266.29638-Methoxymethyl-1-methyl-3-(2-methylpropyl) Xanthine
CAS:Controlled ProductApplications A specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase. Selective PDE1 inhibitor.
References Ahlstroem, M., Cell. Mol. Biol. Lett., 10, 305 (2005), Marte, A., et al.: J. Neurosci. Res., 86, 3338 (2008),Formula:C12H18N4O3Color and Shape:NeatMolecular weight:266.38-Methoxymethyl-1-methyl-3-(2-methylpropyl) xanthine
CAS:Controlled Product8-Methoxymethyl-1-methyl-3-(2-methylpropyl) xanthine (8MMX) is an intracellular calcium ion chelator that inhibits enzyme activity in the cyclic nucleotide phosphodiesterase enzyme family. 8MMX has been shown to be a potent inhibitor of both cyclic nucleotide phosphodiesterases and cyclic nucleotide phosphodiesterase isoenzymes. 8MMX has been shown to inhibit bladder contractility and improve bladder function in animal models. It also reduces the incidence of papillary muscle rupture, which can lead to heart failure, and improves ventricular function by increasing the rate of relaxation of the left ventricle. 8MMX is a potential treatment for pulmonary hypertension, which is caused by increased concentrations of intracellular calcium ions.Formula:C12H18N4O3Purity:Min. 95%Molecular weight:266.3 g/molMMPX
CAS:calmodulin-sensitive cyclic GMP phosphodiesterase inhibitorFormula:C12H18N4O3Purity:98%Color and Shape:SolidMolecular weight:266.3




