CymitQuimica logo

CAS 78033-18-8

:

5,6-diamino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione

Description:
5,6-Diamino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4(1H,3H)-dione, with the CAS number 78033-18-8, is a pyrimidine derivative characterized by the presence of two amino groups at positions 5 and 6, a methyl group at position 3, and a branched alkyl substituent (2-methylpropyl) at position 1. This compound features a dione functional group, indicating the presence of two carbonyl groups, which contribute to its reactivity and potential biological activity. The molecular structure suggests it may participate in hydrogen bonding due to the amino groups, enhancing its solubility in polar solvents. Its unique arrangement of functional groups may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the methyl and branched alkyl groups, which may affect its interaction with biological targets. Overall, this compound represents a complex structure with potential applications in pharmaceuticals or biochemistry.
Formula:C9H16N4O2
InChI:InChI=1/C9H16N4O2/c1-5(2)4-13-7(11)6(10)8(14)12(3)9(13)15/h5H,4,10-11H2,1-3H3
SMILES:CC(C)Cn1c(c(c(=O)n(C)c1=O)N)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.