CymitQuimica logo

CAS 78033-69-9

:

4-bromo-1-hydroxy-2,2,5,5-tetramethyl-pyrrole-3-carboxylic acid

Description:
4-Bromo-1-hydroxy-2,2,5,5-tetramethyl-pyrrole-3-carboxylic acid is a chemical compound characterized by its unique pyrrole structure, which includes a bromine substituent and a hydroxyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of multiple methyl groups on the pyrrole ring enhances its steric bulk and may influence its reactivity and solubility in various solvents. The bromine atom introduces a halogen, which can participate in further chemical reactions, such as nucleophilic substitutions. This compound is of interest in organic synthesis and may have applications in pharmaceuticals or agrochemicals due to its structural characteristics. Its molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect its physical properties, such as melting point and solubility. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C9H14BrNO3
InChI:InChI=1/C9H14BrNO3/c1-8(2)5(7(12)13)6(10)9(3,4)11(8)14/h14H,1-4H3,(H,12,13)
SMILES:CC1(C)C(=C(C(C)(C)N1O)Br)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.