CAS 78050-80-3

ethyl 2,7,7-trimethyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate

Description:

Ethyl 2,7,7-trimethyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate, with the CAS number 78050-80-3, is a complex organic compound characterized by its unique structure, which includes a hexahydroquinoline core and various functional groups. This compound features a carboxylate ester group, contributing to its potential reactivity and solubility properties. The presence of trifluoromethyl and multiple methyl groups indicates that it may exhibit significant lipophilicity, which can influence its biological activity and interaction with other molecules. The oxo group suggests potential for further chemical transformations, while the hexahydroquinoline structure may impart specific pharmacological properties. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, including anti-inflammatory or antimicrobial activities. However, detailed studies on its specific properties, such as solubility, stability, and biological effects, would be necessary to fully understand its utility in various applications.

Formula: C₂₂H₂₄F₃NO₃

InChI: InChI=1/C22H24F3NO3/c1-5-29-20(28)17-12(2)26-15-10-21(3,4)11-16(27)19(15)18(17)13-8-6-7-9-14(13)22(23,24)25/h6-9,18,26H,5,10-11H2,1-4H3

SMILES: CCOC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1ccccc1C(F)(F)F

Synonyms:

• 3-Quinolinecarboxylic Acid, 1,4,5,6,7,8-Hexahydro-2,7,7-Trimethyl-5-Oxo-4-[2-(Trifluoromethyl)Phenyl]-, Ethyl Ester