CAS 78056-28-7
:3-Methyl-1-adamantanamine
Description:
3-Methyl-1-adamantanamine, also known as memantine, is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon. It features a primary amine group and a methyl substituent at the 3-position of the adamantane framework. This compound is known for its neuroprotective properties and is primarily used in the treatment of Alzheimer's disease and other cognitive disorders. Memantine acts as an NMDA receptor antagonist, helping to regulate glutamate activity in the brain, which is crucial for learning and memory. The compound is typically administered in its hydrochloride salt form, enhancing its solubility and bioavailability. In terms of physical properties, 3-Methyl-1-adamantanamine is a white to off-white crystalline powder, with moderate solubility in water and organic solvents. Its pharmacological profile includes a relatively low affinity for nicotinic receptors, making it distinct from other cognitive enhancers. Overall, 3-Methyl-1-adamantanamine is significant in medicinal chemistry for its therapeutic applications in neurodegenerative diseases.
Formula:C11H19N
InChI:InChI=1S/C11H19N/c1-10-3-8-2-9(4-10)6-11(12,5-8)7-10/h8-9H,2-7,12H2,1H3
SMILES:CC12CC3CC(C1)CC(C3)(C2)N
Synonyms:- 1-Amino-3-methyladamantane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
