CAS 78064-96-7

1-(4-cyanobenzyl)pyrrolidinium

Description:

1-(4-Cyanobenzyl)pyrrolidinium, with the CAS number 78064-96-7, is an organic compound that features a pyrrolidinium cation and a 4-cyanobenzyl group. This substance is characterized by its quaternary ammonium structure, which typically imparts it with ionic properties. The presence of the cyanobenzyl group contributes to its potential applications in various fields, including materials science and pharmaceuticals. The compound is likely to exhibit solubility in polar solvents due to its ionic nature, while the cyanide group may influence its reactivity and interaction with other chemical species. Additionally, the pyrrolidinium moiety can affect the compound's stability and its behavior in different environments, such as in ionic liquids or as a surfactant. Overall, 1-(4-cyanobenzyl)pyrrolidinium is of interest for its unique structural features and potential utility in advanced chemical applications.

Formula: C₁₂H₁₅N₂

InChI: InChI=1/C12H14N2/c13-9-11-3-5-12(6-4-11)10-14-7-1-2-8-14/h3-6H,1-2,7-8,10H2/p+1

4-(Pyrrolidin-1-ylmethyl)benzonitrile hydrochloride

CAS: 78064-96-7

Formula: C₁₂H₁₄N₂

Molecular weight: 186.2530

Ref: IN-DA0055FJ

4-(Pyrrolidin-1-ylmethyl)benzonitrile

CAS: 78064-96-7

4-(Pyrrolidin-1-ylmethyl)benzonitrile

Purity: 98%

Molecular weight: 186.25g/mol

Ref: 54-OR910409