CAS 78065-00-6

1-[1-(4-Bromophenyl)ethyl]pyrrolidine

Description:

1-[1-(4-Bromophenyl)ethyl]pyrrolidine, with the CAS number 78065-00-6, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a 4-bromophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the brominated phenyl group and the cyclic amine. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its solubility profile is expected to vary, being more soluble in organic solvents than in water, which is common for many organic compounds with aromatic structures. Safety data should be consulted for handling and usage, as brominated compounds can pose health risks.

Formula: C₁₂H₁₆BrN

InChI: InChI=1S/C12H16BrN/c1-10(14-8-2-3-9-14)11-4-6-12(13)7-5-11/h4-7,10H,2-3,8-9H2,1H3

InChI key: InChIKey=QGCHPDGYVYGLTE-UHFFFAOYSA-N

SMILES: C(C)(C1=CC=C(Br)C=C1)N2CCCC2

Synonyms:

• Pyrrolidine, 1-[1-(4-bromophenyl)ethyl]-
• 1-[1-(4-Bromophenyl)ethyl]pyrrolidine