CAS 78071-30-4

4-methylthiophene-3-carboxylic acid

Description:

4-Methylthiophene-3-carboxylic acid is an organic compound characterized by its thiophene ring structure, which includes a methyl group and a carboxylic acid functional group. The presence of the methyl group at the 4-position and the carboxylic acid at the 3-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. It exhibits acidic behavior, allowing it to participate in various chemical reactions, such as esterification and amidation. The thiophene ring provides aromatic stability and can undergo electrophilic substitution reactions. Additionally, 4-methylthiophene-3-carboxylic acid may have applications in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. Its specific reactivity and interactions can be influenced by the substituents on the thiophene ring, making it a compound of interest in both academic and industrial research.

Formula: C₆H₆O₂S

InChI: InChI=1/C6H6O2S/c1-4-2-9-3-5(4)6(7)8/h2-3H,1H3,(H,7,8)

SMILES: Cc1cscc1C(=O)O

Synonyms:

• 3-Thiophenecarboxylic Acid, 4-Methyl-

4-Methylthiophene-3-carboxylic acid

CAS: 78071-30-4

Formula: C₆H₆O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.1756

Ref: IN-DA008NQL

4-Methylthiophene-3-carboxylic acid

CAS: 78071-30-4

4-Methylthiophene-3-carboxylic acid

Purity: 97%

Molecular weight: 142.18g/mol

Ref: 54-OR919078

4-Methylthiophene-3-carboxylic acid

CAS: 78071-30-4

Formula: C₆H₆O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.17

Ref: 10-F224039

4-methylthiophene-3-carboxylic acid

Controlled Product

CAS: 78071-30-4

Applications 4-methylthiophene-3-carboxylic acid (cas# 78071-30-4) is a useful research chemical.

Formula: C₆H₆O₂S

Color and Shape: Neat

Molecular weight: 142.18

Ref: TR-B101806