CAS 780721-73-5
:4-Bromo-3-fluorobenzenecarboximidamide
Description:
4-Bromo-3-fluorobenzenecarboximidamide is an organic compound characterized by the presence of a bromine atom and a fluorine atom attached to a benzene ring, along with a carboximidamide functional group. This compound features a benzene ring substituted at the 4-position with a bromine atom and at the 3-position with a fluorine atom, which can influence its reactivity and interaction with biological systems. The carboximidamide group contributes to its potential as a ligand in coordination chemistry and may exhibit biological activity, making it of interest in pharmaceutical research. The presence of halogens typically enhances the compound's lipophilicity and can affect its solubility in various solvents. Additionally, the structural features of 4-Bromo-3-fluorobenzenecarboximidamide may allow for specific interactions with target molecules, which is crucial in drug design and development. Overall, this compound's unique combination of functional groups and substituents makes it a valuable subject for further study in both synthetic and medicinal chemistry.
Formula:C7H6BrFN2
InChI:InChI=1S/C7H6BrFN2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H3,10,11)
InChI key:InChIKey=UIRFKNNTWPOYEZ-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=CC(F)=C(Br)C=C1
Synonyms:- Benzenecarboximidamide, 4-bromo-3-fluoro-
- 4-Bromo-3-fluorobenzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.