CAS 780722-30-7

2-(chloromethyl)-1-ethyl-1H-imidazole

Description:

2-(Chloromethyl)-1-ethyl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) and an ethyl group (-C2H5) attached to the imidazole ring, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the chloromethyl group makes it a useful intermediate for further chemical modifications, such as nucleophilic substitutions. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which enhances its utility in various chemical reactions. Safety considerations should be taken into account due to the presence of chlorine, which can pose health risks if not handled properly. Overall, 2-(chloromethyl)-1-ethyl-1H-imidazole is of interest in the development of pharmaceuticals and agrochemicals, owing to its unique structural features and reactivity.

Formula: C₆H₉ClN₂

InChI: InChI=1/C6H9ClN2/c1-2-9-4-3-8-6(9)5-7/h3-4H,2,5H2,1H3

SMILES: CCn1ccnc1CCl

Synonyms:

• 1H-imidazole, 2-(chloromethyl)-1-ethyl-