CAS 780728-19-0

(1Z)-2-(2-chloro-6-fluorophenyl)ethanimidamide

Description:

(1Z)-2-(2-chloro-6-fluorophenyl)ethanimidamide is a chemical compound characterized by its specific structural features, including an ethanimidamide backbone and a substituted aromatic ring. The presence of a chlorine atom and a fluorine atom on the phenyl group contributes to its unique reactivity and potential biological activity. This compound is typically classified as an organic amide, which may exhibit properties such as solubility in polar solvents and potential interactions with biological targets due to its functional groups. The (1Z) designation indicates the configuration of the double bond in the ethanimidamide portion, which can influence its stereochemistry and, consequently, its biological activity. Compounds like this are often studied for their pharmacological properties, including potential use in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, this compound represents a class of molecules that may have significant implications in drug development and chemical research.

Formula: C₈H₈ClFN₂

InChI: InChI=1/C8H8ClFN2/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H3,11,12)

SMILES: c1cc(c(CC(=N)N)c(c1)F)Cl