CAS 780769-67-7

2,2-difluoro-2-(8-quinolyl)ethanamine

Description:

2,2-Difluoro-2-(8-quinolyl)ethanamine is a chemical compound characterized by its unique structure, which includes a difluoroethyl group and a quinoline moiety. The presence of two fluorine atoms on the ethyl group enhances its lipophilicity and may influence its biological activity. The quinoline ring contributes to the compound's potential as a pharmacophore, often associated with various biological activities, including antimicrobial and antitumor properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the amine functional group indicates that it can participate in hydrogen bonding, which may affect its reactivity and interactions in biological systems. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns. Overall, 2,2-difluoro-2-(8-quinolyl)ethanamine represents a compound of interest for further research in drug development and chemical synthesis.

Formula: C₁₁H₁₀F₂N₂

InChI: InChI=1/C11H10F2N2/c12-11(13,7-14)9-5-1-3-8-4-2-6-15-10(8)9/h1-6H,7,14H2

SMILES: c1cc2cccnc2c(c1)C(CN)(F)F

Synonyms:

• 2,2-Difluoro-2-(Quinolin-8-Yl)Ethanamine
• 8-Quinolineethanamine, Β,Β-Difluoro-