CymitQuimica logo

CAS 780769-87-1

:

2-(5-chloro-2-pyridyl)-2,2-difluoro-ethanamine

Description:
2-(5-Chloro-2-pyridyl)-2,2-difluoro-ethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and an amino group attached to a difluoroethyl moiety. This compound typically exhibits properties associated with both amines and halogenated organic compounds. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its structural features that may influence biological activity. The presence of the difluoro group can enhance lipophilicity and metabolic stability, while the pyridine ring may contribute to its ability to interact with biological targets. Additionally, the chlorine atom can affect the compound's reactivity and solubility. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, 2-(5-chloro-2-pyridyl)-2,2-difluoro-ethanamine represents a class of compounds that may have significant utility in various chemical applications.
Formula:C7H7ClF2N2
InChI:InChI=1/C7H7ClF2N2/c8-5-1-2-6(12-3-5)7(9,10)4-11/h1-3H,4,11H2
SMILES:c1cc(C(CN)(F)F)ncc1Cl
Synonyms:
  • 2-(5-Chloropyridin-2-Yl)-2,2-Difluoroethanamine
  • 2-Pyridineethanamine, 5-Chloro-Β,Β-Difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.