
CAS 780800-75-1
:3-(2-Propen-1-yloxy)-2-pyridinecarboxaldehyde
Description:
3-(2-Propen-1-yloxy)-2-pyridinecarboxaldehyde, with the CAS number 780800-75-1, is an organic compound characterized by its pyridine ring and an aldehyde functional group. This compound features a propenyloxy substituent, which contributes to its reactivity and potential applications in organic synthesis. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The pyridine ring provides aromatic stability and can engage in electrophilic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility properties are likely influenced by the polar aldehyde and pyridine functionalities, while the propenyloxy group may enhance its reactivity in polymerization or cross-coupling reactions. Overall, 3-(2-Propen-1-yloxy)-2-pyridinecarboxaldehyde is a versatile building block in organic chemistry, with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c1-2-6-12-9-4-3-5-10-8(9)7-11/h2-5,7H,1,6H2
InChI key:InChIKey=NZOCMZKGTHKDSY-UHFFFAOYSA-N
SMILES:O(CC=C)C1=C(C=O)N=CC=C1
Synonyms:- 3-(2-Propen-1-yloxy)-2-pyridinecarboxaldehyde
- 2-Pyridinecarboxaldehyde, 3-(2-propen-1-yloxy)-
- 2-Pyridinecarboxaldehyde, 3-(2-propenyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.