CAS 780803-63-6

1-(3-methyl-2-pyridyl)ethanamine

Description:

1-(3-Methyl-2-pyridyl)ethanamine, identified by its CAS number 780803-63-6, is an organic compound characterized by its pyridine ring structure, which contributes to its aromatic properties. This compound features an ethylamine group attached to a pyridine ring that has a methyl substituent at the 3-position. The presence of the nitrogen atom in the amine group imparts basicity to the molecule, allowing it to participate in various chemical reactions, including protonation and nucleophilic attacks. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, which enhances its utility in various chemical applications, including as a building block in organic synthesis and potential pharmaceutical intermediates. Additionally, the presence of the pyridine moiety may influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₁₂N₂

InChI: InChI=1/C8H12N2/c1-6-4-3-5-10-8(6)7(2)9/h3-5,7H,9H2,1-2H3

SMILES: Cc1cccnc1C(C)N

Synonyms:

• 1-(3-Methylpyridin-2-Yl)Ethanamine
• 2-Pyridinemethanamine, Α,3-Dimethyl-

[1-(3-Methylpyridin-2-yl)ethyl]amine

CAS: 780803-63-6

Formula: C₈H₁₂N₂

Purity: 95%

Molecular weight: 136.1943

Ref: IN-DA008NQ5

1-(3-Methylpyridin-2-yl)ethanamine

CAS: 780803-63-6

1-(3-Methylpyridin-2-yl)ethanamine

Purity: 95%

Molecular weight: 136.2g/mol

Ref: 54-OR1052544

[1-(3-Methylpyridin-2-yl)ethyl]amine

CAS: 780803-63-6

1-(3-Methylpyridin-2-yl)ethyl]amine is a fine chemical that is a useful building block for research chemicals, reagents and speciality chemicals. It is used as a reaction component and as an intermediate in the synthesis of various complex compounds. 1-(3-Methylpyridin-2-yl)ethyl]amine is also versatile and can be used as a scaffold in organic synthesis.

Formula: C₈H₁₂N₂

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 136.19 g/mol

Ref: 3D-FM121577

1-(3-methyl-2-pyridinyl)ethanamine

CAS: 780803-63-6

Formula: C₈H₁₂N₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 136.198

Ref: 10-F310731