CymitQuimica logo

CAS 780813-06-1

:

[2-(4-bromophenyl)-5-oxocyclopent-1-en-1-yl]acetic acid

Description:
[2-(4-bromophenyl)-5-oxocyclopent-1-en-1-yl]acetic acid, with the CAS number 780813-06-1, is a chemical compound characterized by its unique structure that includes a cyclopentene ring and a bromophenyl group. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions. Additionally, the acetic acid moiety suggests potential acidity, which may influence its solubility and interaction with biological systems. The compound's structural features may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, its distinctive characteristics, including the combination of aromatic and aliphatic components, position it as a versatile compound in both research and industrial applications.
Formula:C13H11BrO3
InChI:InChI=1/C13H11BrO3/c14-9-3-1-8(2-4-9)10-5-6-12(15)11(10)7-13(16)17/h1-4H,5-7H2,(H,16,17)
SMILES:c1cc(ccc1C1=C(CC(=O)O)C(=O)CC1)Br
Synonyms:
  • 1-Cyclopentene-1-Acetic Acid, 2-(4-Bromophenyl)-5-Oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.