CAS 780820-43-1

(3-trimethylsilyl-2-naphthyl) trifluoromethanesulfonate

Description:

(3-Trimethylsilyl-2-naphthyl) trifluoromethanesulfonate, with CAS number 780820-43-1, is an organosilicon compound characterized by the presence of a naphthalene ring substituted with a trimethylsilyl group and a trifluoromethanesulfonate moiety. This compound typically exhibits properties such as high thermal stability and solubility in organic solvents, making it useful in various chemical reactions, particularly in organic synthesis and as a reagent in electrophilic aromatic substitutions. The trifluoromethanesulfonate group is known for its strong electrophilic character, which enhances the reactivity of the naphthyl moiety. Additionally, the presence of the trimethylsilyl group can provide steric hindrance, influencing the compound's reactivity and selectivity in chemical transformations. Overall, this compound is valuable in synthetic organic chemistry, particularly in the development of complex molecules and in applications requiring specific reactivity patterns.

Formula: C₁₄H₁₅F₃O₃SSi

InChI: InChI=1/C14H15F3O3SSi/c1-22(2,3)13-9-11-7-5-4-6-10(11)8-12(13)20-21(18,19)14(15,16)17/h4-9H,1-3H3

SMILES: C[Si](C)(C)c1cc2ccccc2cc1OS(=O)(=O)C(F)(F)F

3-(Trimethylsilyl)-2-naphthyl Trifluoromethanesulfonate

CAS: 780820-43-1

Formula: C₁₄H₁₅F₃O₃SSi

Purity: >95.0%(GC)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 348.41

Ref: 3B-T2466

3-(Trimethylsilyl)-2-naphthyl Trifluoromethanesulfonate

CAS: 780820-43-1

Formula: C₁₄H₁₅F₃O₃SSi

Purity: 95%

Color and Shape: Liquid

Molecular weight: 348.4128

Ref: IN-DA003IBB

3-(Trimethylsilyl)naphthalen-2-yl trifluoromethanesulfonate

CAS: 780820-43-1

3-(Trimethylsilyl)naphthalen-2-yl trifluoromethanesulfonate

Purity: 95%

Molecular weight: 348.41g/mol

Ref: 54-PC103413

3-(Trimethylsilyl)naphthalen-2-yl trifluoromethanesulfonate

CAS: 780820-43-1

Purity: 95%

Color and Shape: Viscous Liquid

Molecular weight: 348.4100037

Ref: 10-F724272

3-(Trimethylsilyl)-2-naphthyl trifluoromethanesulfonate

CAS: 780820-43-1

3-(Trimethylsilyl)-2-naphthyl trifluoromethanesulfonate is a synthetic molecule that is used to synthesize benzofurans. 3-(Trimethylsilyl)-2-naphthyl trifluoromethanesulfonate is activated by reaction with N-bromosuccinimide, which creates an electrophilic carbon center. This electrophilic center reacts with nucleophiles such as alcohols, amines, and thiols to form a new bond. The product of this reaction is benzoylated, which can then undergo further reactions to form other compounds. X-ray crystallography has been used to characterize the structure of 3-(trimethylsilyl)-2-naphthyl trifluoromethanesulfonate.

Formula: C₁₄H₁₅F₃O₃SSi

Purity: Min. 95%

Color and Shape: Colorless Clear Liquid

Molecular weight: 348.41 g/mol

Ref: 3D-FT60049