CAS 780820-69-1

3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide hydrochloride

Description:

3-(Fluoromethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide hydrochloride is a chemical compound characterized by its unique structure, which includes a tetrahydroisoquinoline core, a fluoromethyl group, and a sulfonamide functional group. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the sulfonamide group, which enhances its hydrophilicity. The hydrochloride salt form indicates that it is a protonated species, which can influence its stability and solubility. This compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of drugs targeting various diseases. Its fluoromethyl substituent can enhance metabolic stability and lipophilicity, making it an interesting candidate for further research in drug design. As with many sulfonamides, it may also possess antibacterial properties, although specific biological activities would need to be confirmed through empirical studies.

Formula: C₁₀H₁₄ClFN₂O₂S

InChI: InChI=1/C10H13FN2O2S.ClH/c11-5-9-3-7-1-2-10(16(12,14)15)4-8(7)6-13-9;/h1-2,4,9,13H,3,5-6H2,(H2,12,14,15);1H

SMILES: c1cc(cc2CNC(Cc12)CF)S(=O)(=O)N.Cl