CAS 780820-78-2
:3-(fluoromethyl)-1-oxo-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide
Description:
3-(Fluoromethyl)-1-oxo-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core, a sulfonamide group, and a fluoromethyl substituent. This compound typically exhibits properties associated with both the isoquinoline and sulfonamide functionalities, such as potential biological activity and solubility in polar solvents. The presence of the fluoromethyl group may enhance lipophilicity and influence the compound's interaction with biological targets. The sulfonamide moiety is known for its role in medicinal chemistry, often contributing to antibacterial and diuretic properties. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetics and pharmacodynamics. As with many organic compounds, its stability, reactivity, and potential applications in drug development would depend on specific environmental conditions and the presence of other functional groups. Overall, this compound represents a unique combination of features that could be explored for therapeutic applications.
Formula:C10H11FN2O3S
InChI:InChI=1/C10H11FN2O3S/c11-5-7-3-6-1-2-8(17(12,15)16)4-9(6)10(14)13-7/h1-2,4,7H,3,5H2,(H,13,14)(H2,12,15,16)
SMILES:c1cc(cc2c1CC(CF)N=C2O)S(=O)(=O)N
Synonyms:- 7-Isoquinolinesulfonamide, 3-(Fluoromethyl)-1,2,3,4-Tetrahydro-1-Oxo-
- 3-(FLUOROMETHYL)-1-OXO-1,2,3,4-TETRAHYDROISOQUINOLINE-7-SULFONAMIDE
- 3-FLUOROMETHYL-1-OXO-1,2,3,4-TETRAHYDRO-ISOQUINOLINE-7-SULFONIC ACID AMIDE
- 3-(fluoromethyl)-1-oxo-3,4-dihydro-2H-isoquinoline-7-sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.