CAS 78096-14-7
:3-[(2-Ethoxyphenyl)amino]-3-oxopropanoic acid
Description:
3-[(2-Ethoxyphenyl)amino]-3-oxopropanoic acid, with the CAS number 78096-14-7, is an organic compound characterized by its unique structure, which includes an amino group, a ketone, and a carboxylic acid functional group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. The ethoxyphenyl group may contribute to its lipophilicity, enhancing its ability to penetrate biological membranes. Additionally, the compound may exhibit various biological activities, including anti-inflammatory or analgesic properties, making it of interest in medicinal chemistry. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature. Proper handling and storage are essential to maintain its integrity and efficacy in research or application settings.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c1-2-16-9-6-4-3-5-8(9)12-10(13)7-11(14)15/h3-6H,2,7H2,1H3,(H,12,13)(H,14,15)
InChI key:InChIKey=LYFXACMWURMVPX-UHFFFAOYSA-N
SMILES:N(C(CC(O)=O)=O)C1=C(OCC)C=CC=C1
Synonyms:- 3-[(2-Ethoxyphenyl)amino]-3-oxopropanoic acid
- 2-[(2-Ethoxyphenyl)carbamoyl]acetic acid
- Propanoic acid, 3-[(2-ethoxyphenyl)amino]-3-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.