CAS 78099-29-3
:Benzenamine, 4-ethenyl-N,N-diphenyl-, homopolymer
Description:
Benzenamine, 4-ethenyl-N,N-diphenyl-, homopolymer, commonly referred to as poly(4-vinyl-N,N-diphenylamine), is a synthetic polymer characterized by its unique structure derived from the polymerization of 4-vinyl-N,N-diphenylamine monomers. This polymer exhibits notable electrical conductivity, making it of interest in applications such as organic electronics and conductive coatings. Its structure includes a backbone of carbon atoms with pendant diphenylamine groups, which contribute to its electronic properties and stability. The polymer is typically insoluble in water but may dissolve in organic solvents, depending on its molecular weight and degree of polymerization. Additionally, it demonstrates thermal stability and can withstand moderate temperatures without significant degradation. The presence of the diphenylamine moiety imparts antioxidant properties, which can enhance the longevity of materials in various applications. Overall, this polymer is valued for its potential in advanced materials science, particularly in the development of conductive and semiconductive materials.
Formula:(C20H17N)x
InChI:InChI=1S/C20H17N/c1-2-17-13-15-20(16-14-17)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h2-16H,1H2
InChI key:InChIKey=BGGDZDRRHQTSPV-UHFFFAOYSA-N
SMILES:N(C1=CC=C(C=C)C=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 4-(Diphenylamino)styrene homopolymer
- 4-Vinyltriphenylamine homopolymer
- Benzenamine, 4-ethenyl-N,N-diphenyl-, homopolymer
- Poly(4-vinyltriphenylamine)
- p-(N,N-Diphenylamino)styrene homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
