CAS 781-03-3
:3-methylbut-3-en-1-yl 4-methylbenzenesulfonate
Description:
3-Methylbut-3-en-1-yl 4-methylbenzenesulfonate, with the CAS number 781-03-3, is an organic compound characterized by its sulfonate ester functional group. This compound features a 4-methylbenzenesulfonate moiety, which contributes to its reactivity and solubility properties. The presence of the 3-methylbut-3-en-1-yl group indicates that it has a branched alkene structure, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and polymerization processes. The sulfonate group enhances the compound's ability to act as a leaving group in reactions, facilitating the formation of more complex molecules. Additionally, the compound's structure suggests it may exhibit specific physical properties such as moderate volatility and solubility in polar organic solvents. Its applications may extend to fields such as organic synthesis, pharmaceuticals, and materials science, where it can serve as an intermediate or a reagent. Safety and handling precautions should be observed, as with many sulfonate esters, due to potential reactivity and toxicity.
Formula:C12H16O3S
InChI:InChI=1/C12H16O3S/c1-10(2)8-9-15-16(13,14)12-6-4-11(3)5-7-12/h4-7H,1,8-9H2,2-3H3
SMILES:C=C(C)CCOS(=O)(=O)c1ccc(C)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
