CymitQuimica logo

CAS 78101-25-4

:

2-[2-[2-[(1-Oxohexadecyl)oxy]ethoxy]ethoxy]ethyl octadecanoate

Description:
2-[2-[2-[(1-Oxohexadecyl)oxy]ethoxy]ethoxy]ethyl octadecanoate, with the CAS number 78101-25-4, is a complex ester compound characterized by its long hydrocarbon chains and ether linkages. This substance features a hexadecyl group, which contributes to its hydrophobic properties, making it soluble in organic solvents while being less soluble in water. The presence of multiple ethoxy groups enhances its potential as a surfactant, allowing it to reduce surface tension and improve emulsification in various formulations. Its octadecanoate moiety, derived from stearic acid, adds to its fatty nature, which can influence its physical properties such as melting point and viscosity. This compound is often utilized in cosmetic and pharmaceutical applications due to its emulsifying and stabilizing properties, as well as its ability to enhance the delivery of active ingredients. Additionally, its structure suggests potential biocompatibility, making it suitable for use in formulations intended for skin contact. Overall, this compound exemplifies the characteristics of surfactants and emulsifiers in industrial and consumer products.
Formula:C40H78O6
InChI:InChI=1S/C40H78O6/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-40(42)46-38-36-44-34-33-43-35-37-45-39(41)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h3-38H2,1-2H3
InChI key:InChIKey=GLAJMFARNFZCGO-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCCCCCCCCCC)=O)CCOCCOCCOC(CCCCCCCCCCCCCCC)=O
Synonyms:
  • Octadecanoic acid, 2-[2-[2-[(1-oxohexadecyl)oxy]ethoxy]ethoxy]ethyl ester
  • 2-[2-[2-[(1-Oxohexadecyl)oxy]ethoxy]ethoxy]ethyl octadecanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.