CAS 78101-74-3

Guanosine 5′-(trihydrogen diphosphate), 2′-deoxy-, sodium salt (1:2)

Description:

Guanosine 5′-(trihydrogen diphosphate), 2′-deoxy-, sodium salt (1:2), commonly referred to as dGTP, is a nucleotide that plays a crucial role in cellular metabolism and biochemistry. It is a derivative of guanosine, consisting of a guanine base, a deoxyribose sugar, and a triphosphate group. The sodium salt form indicates that sodium ions are associated with the molecule, which can influence its solubility and stability in aqueous solutions. dGTP is essential for DNA synthesis, serving as a building block for nucleic acids during replication and transcription processes. Its structure allows it to participate in energy transfer reactions, similar to ATP, due to the high-energy phosphate bonds present in the triphosphate moiety. Additionally, dGTP is involved in various signaling pathways and enzymatic reactions, making it a vital component in cellular functions. The compound is typically stored under controlled conditions to maintain its integrity and is used in various biochemical applications, including molecular biology techniques.

Formula: C₁₀H₁₅N₅O₁₀P₂·2Na

InChI: InChI=1S/C10H15N5O10P2.2Na/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(24-6)2-23-27(21,22)25-26(18,19)20;;/h3-6,16H,1-2H2,(H,21,22)(H2,18,19,20)(H3,11,13,14,17);;/t4-,5+,6+;;/m0../s1

InChI key: InChIKey=YSPCAXKMEJAUOT-FVALZTRZSA-N

SMILES: O=C1C2=C(N(C=N2)[C@@H]3O[C@H](COP(OP(=O)(O)O)(=O)O)[C@@H](O)C3)NC(N)=N1.[Na]

Synonyms:

• 2'-Deoxyguanosine-5'-diphosphate,Disodium salt
• Guanosine 5′-(trihydrogen diphosphate), 2′-deoxy-, sodium salt (1:2)
• Guanosine 5′-(trihydrogen diphosphate), 2′-deoxy-, disodium salt

2'-Deoxyguanosine-5'-Diphosphate Disodium Salt

CAS: 78101-74-3

2'-Deoxyguanosine-5'-Diphosphate Disodium Salt

Purity: 98%

Molecular weight: 471.16g/mol

Ref: 54-OR1024342

2'-Deoxyguanosine-5'-diphosphate Disodium Salt

Controlled Product

CAS: 78101-74-3

Applications 2'-Deoxyguanosine-5'-diphosphate disodium salt (cas# 78101-74-3) is a useful research chemical.

Formula: C₁₀H₁₃N₅Na₂O₁₀P₂

Color and Shape: Neat

Molecular weight: 471.165

Ref: TR-D242443

2'-Deoxyguanosine-5'-diphosphate disodium salt

CAS: 78101-74-3

2'-Deoxyguanosine-5'-diphosphate disodium salt is a marine metabolite that is used as a chemotactic agent for bacteria. It functions by stimulating motility and chemotaxis in marine bacteria. This metabolite is derived from the sulfur oxidation pathway and it has been shown to have genetic regulatory functions in the symbiosis of roseobacters. 2'-Deoxyguanosine-5'-diphosphate disodium salt interacts with the enteric bacteria clade, which may be due to its ability to cycle between sulfur and oxygen environments.

Formula: C₁₀H₁₃N₅O₁₀P₂·2Na

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 471.16 g/mol

Ref: 3D-ND31607