CAS 78103-27-2

2-deoxy-2-[(fluoroacetyl)amino]-D-mannose

Description:

2-Deoxy-2-[(fluoroacetyl)amino]-D-mannose is a synthetic derivative of D-mannose, an important sugar in various biological processes. This compound features a fluorinated acetylamino group at the second carbon position, which enhances its biochemical properties and potential applications. The presence of the fluorine atom can influence the compound's reactivity and interaction with biological systems, potentially affecting its role in metabolic pathways. As a monosaccharide derivative, it retains the basic structure of mannose, which is a six-carbon aldose sugar, but the modifications can alter its solubility, stability, and biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting specific enzymes or pathways. Its unique structure could also make it a candidate for research in glycomics or as a probe in biochemical assays. However, detailed studies on its pharmacokinetics, toxicity, and specific biological effects would be necessary to fully understand its potential applications.

Formula: C₈H₁₄FNO₆

InChI: InChI=1/C8H14FNO6/c9-1-6(14)10-4(2-11)7(15)8(16)5(13)3-12/h2,4-5,7-8,12-13,15-16H,1,3H2,(H,10,14)/t4-,5-,7-,8-/m1/s1

SMILES: C(C(=N[C@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O)O)F