CAS 78104-88-8
:1-methylcyclopropanecarbonitrile
Description:
1-Methylcyclopropanecarbonitrile, with the CAS number 78104-88-8, is an organic compound characterized by its unique structure, which includes a cyclopropane ring substituted with a methyl group and a carbonitrile functional group. This compound typically appears as a colorless to pale yellow liquid and has a relatively low boiling point, indicative of its volatility. The presence of the carbonitrile group contributes to its polarity, making it soluble in polar solvents while exhibiting limited solubility in non-polar solvents. 1-Methylcyclopropanecarbonitrile is of interest in various chemical applications, including synthesis and as an intermediate in organic reactions. Its reactivity is influenced by the strain in the cyclopropane ring, which can lead to unique chemical behavior under certain conditions. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Overall, this compound serves as a valuable building block in organic chemistry and materials science.
Formula:C5H7N
InChI:InChI=1/C5H7N/c1-5(4-6)2-3-5/h2-3H2,1H3
SMILES:CC1(CC1)C#N
Synonyms:- Cyclopropanecarbonitrile, 1-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.