CAS 78105-42-7
:7,8-Quinolinediamine
Description:
7,8-Quinolinediamine, with the CAS number 78105-42-7, is an organic compound characterized by its structure, which features a quinoline backbone with two amino groups at the 7 and 8 positions. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as solubility in polar solvents, which can vary depending on the specific conditions. The presence of amino groups contributes to its reactivity, allowing it to participate in various chemical reactions, including those involving electrophiles and nucleophiles. Additionally, 7,8-Quinolinediamine may exhibit biological activity, making it of interest for research in medicinal chemistry. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application. Overall, 7,8-Quinolinediamine is a versatile compound with significant potential in both research and industrial applications.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-7-4-3-6-2-1-5-12-9(6)8(7)11/h1-5H,10-11H2
InChI key:InChIKey=UUCNOUOCQLCWFP-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC1N)C=CC=N2
Synonyms:- 7,8-Quinolinediamine
- Quinoline, 7,8-diamino-
- 7,8-Diaminoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.