CymitQuimica logo

CAS 78134-82-4

:

3,10-dihydroxy-2,9-dimethoxy-5,6-dihydroisoquino[3,2-a]isoquinolinium chloride

Description:
3,10-Dihydroxy-2,9-dimethoxy-5,6-dihydroisoquino[3,2-a]isoquinolinium chloride is a complex organic compound characterized by its unique isoquinoline structure, which features multiple hydroxyl and methoxy functional groups. The presence of two hydroxyl groups contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. The methoxy groups can enhance lipophilicity, affecting the compound's interaction with biological membranes. As a quaternary ammonium salt, the chloride ion plays a crucial role in stabilizing the overall structure and may influence its pharmacological properties. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of neuropharmacology and cancer research. Its complex structure suggests that it may exhibit diverse biological activities, although specific data on its efficacy and safety profile would require further investigation. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research in various scientific fields.
Formula:C19H18ClNO4
InChI:InChI=1/C19H17NO4.ClH/c1-23-18-9-13-12(8-17(18)22)5-6-20-10-14-11(7-15(13)20)3-4-16(21)19(14)24-2;/h3-4,7-10,21H,5-6H2,1-2H3;1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Dehydrodiscretamine chloride

    CAS:
    Dehydrodiscretamine chloride, a dual inhibitor of acetylcholinesterase (AChE) and butyrylcholinesterase (BChE), exhibits IC50 values of 17.8 μM and 118.8 μM,
    Formula:C19H18ClNO4
    Color and Shape:Solid
    Molecular weight:359.8

    Ref: TM-T79973

    5mg
    To inquire
    50mg
    To inquire