CAS 78140-47-3

(1-hydroxy-2,2,6,6-tetramethyl-4-piperidyl)imino-triphenyl-$l^{5}-phosphane

Description:

(1-hydroxy-2,2,6,6-tetramethyl-4-piperidyl)imino-triphenyl-$l^{5}-phosphane, with CAS number 78140-47-3, is a chemical compound characterized by its unique structure that includes a piperidine ring and a phosphane moiety. This compound typically exhibits properties associated with both amine and phosphine functionalities, making it a versatile ligand in coordination chemistry. It is known for its stability and ability to form complexes with various metal ions, which can enhance catalytic activity in organic reactions. The presence of the bulky tetramethyl groups contributes to steric hindrance, influencing its reactivity and selectivity in chemical processes. Additionally, the hydroxyl group can participate in hydrogen bonding, potentially affecting solubility and interaction with other molecules. This compound is often utilized in synthetic organic chemistry and materials science, particularly in the development of catalysts and ligands for various applications. Its specific characteristics, such as solubility and reactivity, can vary depending on the solvent and reaction conditions employed.

Formula: C₂₇H₃₃N₂OP

InChI: InChI=1/C27H33N2OP/c1-26(2)20-22(21-27(3,4)29(26)30)28-31(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22,30H,20-21H2,1-4H3

SMILES: CC1(C)CC(CC(C)(C)N1O)N=P(c1ccccc1)(c1ccccc1)c1ccccc1